C17H16N6O3 — CID 17039291
ethyl 5-amino-1-[4-(pyridine-4-carbonylamino)phenyl]triazole-4-carboxylate (PubChem CID 17039291) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is ethyl 5-amino-1-[4-(pyridine-4-carbonylamino)phenyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-[4-(pyridine-4-carbonylamino)phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 17039291 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl 5-amino-1-[4-(pyridine-4-carbonylamino)phenyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(-c2ccc(NC(=O)c3ccncc3)cc2)c1N |
| InChI | InChI=1S/C17H16N6O3/c1-2-26-17(25)14-15(18)23(22-21-14)13-5-3-12(4-6-13)20-16(24)11-7-9-19-10-8-11/h3-10H,2,18H2,1H3,(H,20,24) |
| InChIKey | PJYJRBNAFFUCLB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |