C16H13ClFN5O2 — CID 17015793
5-amino-N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)triazole-4-carboxamide (PubChem CID 17015793) has the molecular formula C16H13ClFN5O2 and a molecular weight of 361.76 g/mol. Its IUPAC name is 5-amino-N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)triazole-4-carboxamide.
| Compound Name | 5-amino-N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 17015793 |
| Molecular Formula | C16H13ClFN5O2 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 5-amino-N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)triazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2nnn(-c3ccc(F)cc3)c2N)cc1Cl |
| InChI | InChI=1S/C16H13ClFN5O2/c1-25-13-7-4-10(8-12(13)17)20-16(24)14-15(19)23(22-21-14)11-5-2-9(18)3-6-11/h2-8H,19H2,1H3,(H,20,24) |
| InChIKey | NYTDZNDYDIAHQU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |