C16H12ClFN4O — CID 2141048
N-(4-chlorophenyl)-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide (PubChem CID 2141048) has the molecular formula C16H12ClFN4O and a molecular weight of 330.75 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 2141048 |
| Molecular Formula | C16H12ClFN4O |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(4-chlorophenyl)-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Cl)cc2)nnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12ClFN4O/c1-10-15(16(23)19-13-6-2-11(17)3-7-13)20-21-22(10)14-8-4-12(18)5-9-14/h2-9H,1H3,(H,19,23) |
| InChIKey | RTVVIVJTLQPHSO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |