C16H11Cl2FN4O — CID 58191737
1-(3-chloro-4-fluorophenyl)-N-(3-chlorophenyl)-5-methyltriazole-4-carboxamide (PubChem CID 58191737) has the molecular formula C16H11Cl2FN4O and a molecular weight of 365.20 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-(3-chlorophenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-(3-chlorophenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 58191737 |
| Molecular Formula | C16H11Cl2FN4O |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-(3-chlorophenyl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(Cl)c2)nnn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2FN4O/c1-9-15(16(24)20-11-4-2-3-10(17)7-11)21-22-23(9)12-5-6-14(19)13(18)8-12/h2-8H,1H3,(H,20,24) |
| InChIKey | VYSAQYRACVPVFE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |