C19H17ClN4O3 — CID 16649515
methyl 3-[[1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carbonyl]amino]benzoate (PubChem CID 16649515) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is methyl 3-[[1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16649515 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | methyl 3-[[1-(3-chloro-4-methylphenyl)-5-methyltriazole-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2nnn(-c3ccc(C)c(Cl)c3)c2C)c1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-11-7-8-15(10-16(11)20)24-12(2)17(22-23-24)18(25)21-14-6-4-5-13(9-14)19(26)27-3/h4-10H,1-3H3,(H,21,25) |
| InChIKey | XARWLGZOLOIGIG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |