C19H18FN5O2 — CID 55599112
1-(4-fluorophenyl)-5-methyl-N-[3-(propanoylamino)phenyl]triazole-4-carboxamide (PubChem CID 55599112) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-N-[3-(propanoylamino)phenyl]triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-N-[3-(propanoylamino)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 55599112 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-N-[3-(propanoylamino)phenyl]triazole-4-carboxamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)c2nnn(-c3ccc(F)cc3)c2C)c1 |
| InChI | InChI=1S/C19H18FN5O2/c1-3-17(26)21-14-5-4-6-15(11-14)22-19(27)18-12(2)25(24-23-18)16-9-7-13(20)8-10-16/h4-11H,3H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | FOSLKVOVUFMLHL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |