C17H12ClN4O3- — CID 7464430
4-[[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]benzoate (PubChem CID 7464430) has the molecular formula C17H12ClN4O3- and a molecular weight of 355.76 g/mol. Its IUPAC name is 4-[[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]benzoate.
| Compound Name | 4-[[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 7464430 |
| Molecular Formula | C17H12ClN4O3- |
| Molecular Weight | 355.76 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-[[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]benzoate |
| SMILES | Cc1c(C(=O)Nc2ccc(C(=O)[O-])cc2)nnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN4O3/c1-10-15(20-21-22(10)14-8-4-12(18)5-9-14)16(23)19-13-6-2-11(3-7-13)17(24)25/h2-9H,1H3,(H,19,23)(H,24,25)/p-1 |
| InChIKey | JSNSBNQKNMHEIV-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |