C14H17ClN4O3 — CID 46858303
1-(4-chlorophenyl)-N-(2,2-dimethoxyethyl)-5-methyltriazole-4-carboxamide (PubChem CID 46858303) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2,2-dimethoxyethyl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(2,2-dimethoxyethyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46858303 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2,2-dimethoxyethyl)-5-methyltriazole-4-carboxamide |
| SMILES | COC(CNC(=O)c1nnn(-c2ccc(Cl)cc2)c1C)OC |
| InChI | InChI=1S/C14H17ClN4O3/c1-9-13(14(20)16-8-12(21-2)22-3)17-18-19(9)11-6-4-10(15)5-7-11/h4-7,12H,8H2,1-3H3,(H,16,20) |
| InChIKey | WHNCGSMSLWHYCR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|