C17H25N5O2 — CID 120831805
5-methyl-N-[2-(methylamino)propyl]-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide (PubChem CID 120831805) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-methyl-N-[2-(methylamino)propyl]-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-(methylamino)propyl]-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 120831805 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 5-methyl-N-[2-(methylamino)propyl]-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
| SMILES | CNC(C)CNC(=O)c1nnn(-c2ccc(OC(C)C)cc2)c1C |
| InChI | InChI=1S/C17H25N5O2/c1-11(2)24-15-8-6-14(7-9-15)22-13(4)16(20-21-22)17(23)19-10-12(3)18-5/h6-9,11-12,18H,10H2,1-5H3,(H,19,23) |
| InChIKey | NCYUXDPCYLJYGZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |