C20H24ClN5O3 — CID 119421043
N-(2-amino-5-methoxyphenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119421043) has the molecular formula C20H24ClN5O3 and a molecular weight of 417.90 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-5-methoxyphenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119421043 |
| Molecular Formula | C20H24ClN5O3 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | COc1ccc(N)c(NC(=O)c2nnn(-c3ccc(OC(C)C)cc3)c2C)c1.Cl |
| InChI | InChI=1S/C20H23N5O3.ClH/c1-12(2)28-15-7-5-14(6-8-15)25-13(3)19(23-24-25)20(26)22-18-11-16(27-4)9-10-17(18)21;/h5-12H,21H2,1-4H3,(H,22,26);1H |
| InChIKey | CXVRLXDLNTXQEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|