C23H30N4O2 — CID 169248286
N-(3-tert-butylphenyl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide;ethane (PubChem CID 169248286) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(3-tert-butylphenyl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide;ethane.
| Compound Name | N-(3-tert-butylphenyl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide;ethane |
|---|---|
| PubChem CID | 169248286 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-(3-tert-butylphenyl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide;ethane |
| SMILES | CC.COc1ccc(-n2nnc(C(=O)Nc3cccc(C(C)(C)C)c3)c2C)cc1 |
| InChI | InChI=1S/C21H24N4O2.C2H6/c1-14-19(23-24-25(14)17-9-11-18(27-5)12-10-17)20(26)22-16-8-6-7-15(13-16)21(2,3)4;1-2/h6-13H,1-5H3,(H,22,26);1-2H3 |
| InChIKey | JRNYPWNAWILHQS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |