C17H14F2N4O3 — CID 91885855
1-[4-(difluoromethoxy)phenyl]-N-(3-hydroxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 91885855) has the molecular formula C17H14F2N4O3 and a molecular weight of 360.32 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-N-(3-hydroxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-N-(3-hydroxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 91885855 |
| Molecular Formula | C17H14F2N4O3 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-N-(3-hydroxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(O)c2)nnn1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H14F2N4O3/c1-10-15(16(25)20-11-3-2-4-13(24)9-11)21-22-23(10)12-5-7-14(8-6-12)26-17(18)19/h2-9,17,24H,1H3,(H,20,25) |
| InChIKey | NJJCKKDFTGOOHT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |