C21H22ClN5O3 — CID 86902978
N-(4-acetamido-2-chlorophenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide (PubChem CID 86902978) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is N-(4-acetamido-2-chlorophenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide.
| Compound Name | N-(4-acetamido-2-chlorophenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 86902978 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-(4-acetamido-2-chlorophenyl)-5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(OC(C)C)cc3)c2C)c(Cl)c1 |
| InChI | InChI=1S/C21H22ClN5O3/c1-12(2)30-17-8-6-16(7-9-17)27-13(3)20(25-26-27)21(29)24-19-10-5-15(11-18(19)22)23-14(4)28/h5-12H,1-4H3,(H,23,28)(H,24,29) |
| InChIKey | YIMHXZZJMJLMPG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |