C19H18ClN3O2 — CID 50763975
(4-chlorophenyl)methyl 1-(4-ethylphenyl)-5-methyltriazole-4-carboxylate (PubChem CID 50763975) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 1-(4-ethylphenyl)-5-methyltriazole-4-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 1-(4-ethylphenyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 50763975 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (4-chlorophenyl)methyl 1-(4-ethylphenyl)-5-methyltriazole-4-carboxylate |
| SMILES | CCc1ccc(-n2nnc(C(=O)OCc3ccc(Cl)cc3)c2C)cc1 |
| InChI | InChI=1S/C19H18ClN3O2/c1-3-14-6-10-17(11-7-14)23-13(2)18(21-22-23)19(24)25-12-15-4-8-16(20)9-5-15/h4-11H,3,12H2,1-2H3 |
| InChIKey | XWIIMPCATBTYGG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |