C16H16F2N4O5 — CID 20852224
diethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]triazole-4,5-dicarboxylate (PubChem CID 20852224) has the molecular formula C16H16F2N4O5 and a molecular weight of 382.32 g/mol. Its IUPAC name is diethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 20852224 |
| Molecular Formula | C16H16F2N4O5 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | diethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nnn(CC(=O)Nc2ccc(F)cc2F)c1C(=O)OCC |
| InChI | InChI=1S/C16H16F2N4O5/c1-3-26-15(24)13-14(16(25)27-4-2)22(21-20-13)8-12(23)19-11-6-5-9(17)7-10(11)18/h5-7H,3-4,8H2,1-2H3,(H,19,23) |
| InChIKey | NXVBERFREBWVKL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |