C14H14F2N2O — CID 110688890
N-(2,4-difluorophenyl)-2-(2,5-dimethylpyrrol-1-yl)acetamide (PubChem CID 110688890) has the molecular formula C14H14F2N2O and a molecular weight of 264.28 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(2,5-dimethylpyrrol-1-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(2,5-dimethylpyrrol-1-yl)acetamide |
|---|---|
| PubChem CID | 110688890 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(2,5-dimethylpyrrol-1-yl)acetamide |
| SMILES | Cc1ccc(C)n1CC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H14F2N2O/c1-9-3-4-10(2)18(9)8-14(19)17-13-6-5-11(15)7-12(13)16/h3-7H,8H2,1-2H3,(H,17,19) |
| InChIKey | WUOUBMOYFNSOTP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |