C12H11F2N3O3 — CID 9209393
N-(2,4-difluorophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 9209393) has the molecular formula C12H11F2N3O3 and a molecular weight of 283.23 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 9209393 |
| Molecular Formula | C12H11F2N3O3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)Nc2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C12H11F2N3O3/c1-16-6-11(19)17(12(16)20)5-10(18)15-9-3-2-7(13)4-8(9)14/h2-4H,5-6H2,1H3,(H,15,18) |
| InChIKey | PUYHUDNEIVPBCT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|