C12H12BrN3O3 — CID 8014767
N-(3-bromophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 8014767) has the molecular formula C12H12BrN3O3 and a molecular weight of 326.15 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8014767 |
| Molecular Formula | C12H12BrN3O3 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-(3-bromophenyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)Nc2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C12H12BrN3O3/c1-15-7-11(18)16(12(15)19)6-10(17)14-9-4-2-3-8(13)5-9/h2-5H,6-7H2,1H3,(H,14,17) |
| InChIKey | OFORXNSJRUULAD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|