C20H20N4O4 — CID 9201030
2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(3-methylphenyl)benzamide (PubChem CID 9201030) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(3-methylphenyl)benzamide.
| Compound Name | 2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 9201030 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)CN2C(=O)CN(C)C2=O)c1 |
| InChI | InChI=1S/C20H20N4O4/c1-13-6-5-7-14(10-13)21-19(27)15-8-3-4-9-16(15)22-17(25)11-24-18(26)12-23(2)20(24)28/h3-10H,11-12H2,1-2H3,(H,21,27)(H,22,25) |
| InChIKey | KBCMNRJUJSHJEN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|