C25H21N3O2 — CID 2223034
N-(3-methylphenyl)-2-(naphthalen-1-ylcarbamoylamino)benzamide (PubChem CID 2223034) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-(naphthalen-1-ylcarbamoylamino)benzamide.
| Compound Name | N-(3-methylphenyl)-2-(naphthalen-1-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 2223034 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(3-methylphenyl)-2-(naphthalen-1-ylcarbamoylamino)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C25H21N3O2/c1-17-8-6-11-19(16-17)26-24(29)21-13-4-5-14-23(21)28-25(30)27-22-15-7-10-18-9-2-3-12-20(18)22/h2-16H,1H3,(H,26,29)(H2,27,28,30) |
| InChIKey | OKDVSWSYMRTCRM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |