C21H22N2O5 — CID 9199226
[2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxopentanoate (PubChem CID 9199226) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxopentanoate.
| Compound Name | [2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 9199226 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(=O)Nc1ccccc1C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-14-6-5-7-16(12-14)22-21(27)17-8-3-4-9-18(17)23-19(25)13-28-20(26)11-10-15(2)24/h3-9,12H,10-11,13H2,1-2H3,(H,22,27)(H,23,25) |
| InChIKey | WKHGKQVPYLHKMR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |