C22H23NO5 — CID 7221760
[2-(2-acetylanilino)-2-oxoethyl] 4-(2,5-dimethylphenyl)-4-oxobutanoate (PubChem CID 7221760) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 4-(2,5-dimethylphenyl)-4-oxobutanoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 4-(2,5-dimethylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7221760 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 4-(2,5-dimethylphenyl)-4-oxobutanoate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)CCC(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C22H23NO5/c1-14-8-9-15(2)18(12-14)20(25)10-11-22(27)28-13-21(26)23-19-7-5-4-6-17(19)16(3)24/h4-9,12H,10-11,13H2,1-3H3,(H,23,26) |
| InChIKey | SNBIXZFFEZZWDN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |