C20H21NO5 — CID 7841781
[2-(2-acetylanilino)-2-oxoethyl] 3-(2-methylphenoxy)propanoate (PubChem CID 7841781) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 3-(2-methylphenoxy)propanoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 3-(2-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 7841781 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 3-(2-methylphenoxy)propanoate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)CCOc1ccccc1C |
| InChI | InChI=1S/C20H21NO5/c1-14-7-3-6-10-18(14)25-12-11-20(24)26-13-19(23)21-17-9-5-4-8-16(17)15(2)22/h3-10H,11-13H2,1-2H3,(H,21,23) |
| InChIKey | XGJQUDZKDRBWAJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |