C24H27NO5 — CID 2420330
[2-(2-acetylanilino)-2-oxoethyl] 4-(4-tert-butylphenyl)-4-oxobutanoate (PubChem CID 2420330) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 4-(4-tert-butylphenyl)-4-oxobutanoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 4-(4-tert-butylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2420330 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 4-(4-tert-butylphenyl)-4-oxobutanoate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)CCC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-16(26)19-7-5-6-8-20(19)25-22(28)15-30-23(29)14-13-21(27)17-9-11-18(12-10-17)24(2,3)4/h5-12H,13-15H2,1-4H3,(H,25,28) |
| InChIKey | KCULISSHAVEGOA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |