C21H23NO4 — CID 2631779
[2-(2-acetylanilino)-2-oxoethyl] 4-tert-butylbenzoate (PubChem CID 2631779) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 4-tert-butylbenzoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2631779 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 4-tert-butylbenzoate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-14(23)17-7-5-6-8-18(17)22-19(24)13-26-20(25)15-9-11-16(12-10-15)21(2,3)4/h5-12H,13H2,1-4H3,(H,22,24) |
| InChIKey | FJWWUUBTFSZOGK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |