C23H29NO3 — CID 2365149
[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-tert-butylbenzoate (PubChem CID 2365149) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is [2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-tert-butylbenzoate.
| Compound Name | [2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2365149 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-tert-butylbenzoate |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)COC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29NO3/c1-6-16(2)19-9-7-8-10-20(19)24-21(25)15-27-22(26)17-11-13-18(14-12-17)23(3,4)5/h7-14,16H,6,15H2,1-5H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | MMBFYACQPPBGSW-MRXNPFEDSA-N |
| XLogP | 5.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |