C24H28N2O4 — CID 7888092
[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 7888092) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 7888092 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)COC(=O)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-3-17(2)20-7-4-5-8-21(20)25-22(27)16-30-24(29)19-12-10-18(11-13-19)15-26-14-6-9-23(26)28/h4-5,7-8,10-13,17H,3,6,9,14-16H2,1-2H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | QRKKZGWCSNNNIE-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |