C21H21ClN2O4 — CID 30811701
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 30811701) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 30811701 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(CN3CCCC3=O)cc2)cc1Cl |
| InChI | InChI=1S/C21H21ClN2O4/c1-14-4-9-17(11-18(14)22)23-19(25)13-28-21(27)16-7-5-15(6-8-16)12-24-10-2-3-20(24)26/h4-9,11H,2-3,10,12-13H2,1H3,(H,23,25) |
| InChIKey | QEYPTEZUELVDJW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |