C19H21N3O4S — CID 27708025
N-(4-methyl-3-sulfamoylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 27708025) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 27708025 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCCC3=O)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H21N3O4S/c1-13-4-9-16(11-17(13)27(20,25)26)21-19(24)15-7-5-14(6-8-15)12-22-10-2-3-18(22)23/h4-9,11H,2-3,10,12H2,1H3,(H,21,24)(H2,20,25,26) |
| InChIKey | MURTYWAOKVCYPI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |