C22H24ClN3O4S — CID 55379495
N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 55379495) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55379495 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H24ClN3O4S/c23-19-10-9-18(14-20(19)31(29,30)26-12-1-2-13-26)24-22(28)17-7-5-16(6-8-17)15-25-11-3-4-21(25)27/h5-10,14H,1-4,11-13,15H2,(H,24,28) |
| InChIKey | LLQYREUWBYHFOZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |