C18H15Cl3N2O2 — CID 94872752
4-[(2-oxopyrrolidin-1-yl)methyl]-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 94872752) has the molecular formula C18H15Cl3N2O2 and a molecular weight of 397.69 g/mol. Its IUPAC name is 4-[(2-oxopyrrolidin-1-yl)methyl]-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 4-[(2-oxopyrrolidin-1-yl)methyl]-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 94872752 |
| Molecular Formula | C18H15Cl3N2O2 |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 4-[(2-oxopyrrolidin-1-yl)methyl]-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H15Cl3N2O2/c19-13-8-15(21)16(9-14(13)20)22-18(25)12-5-3-11(4-6-12)10-23-7-1-2-17(23)24/h3-6,8-9H,1-2,7,10H2,(H,22,25) |
| InChIKey | XVHKSPPBZZMAIF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|