C18H16Cl2N2O2 — CID 51219042
N-(2,3-dichlorophenyl)-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 51219042) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-(2,3-dichlorophenyl)-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 51219042 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c19-14-6-2-7-15(17(14)20)21-18(24)13-5-1-4-12(10-13)11-22-9-3-8-16(22)23/h1-2,4-7,10H,3,8-9,11H2,(H,21,24) |
| InChIKey | PAEBPXYHNPXEOQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |