C23H20Cl2N2O — CID 99950871
N-(2,3-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-ylmethyl)benzamide (PubChem CID 99950871) has the molecular formula C23H20Cl2N2O and a molecular weight of 411.33 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-ylmethyl)benzamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 99950871 |
| Molecular Formula | C23H20Cl2N2O |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-ylmethyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccc(CN2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O/c24-19-7-3-8-20(22(19)25)26-23(28)18-12-10-16(11-13-18)15-27-14-4-6-17-5-1-2-9-21(17)27/h1-3,5,7-13H,4,6,14-15H2,(H,26,28) |
| InChIKey | ZWZDWRBEVJGWLS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |