C21H22ClN3O3S — CID 26375346
3-(azepan-1-ylsulfonyl)-4-chloro-N-[4-(cyanomethyl)phenyl]benzamide (PubChem CID 26375346) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-4-chloro-N-[4-(cyanomethyl)phenyl]benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-[4-(cyanomethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26375346 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-[4-(cyanomethyl)phenyl]benzamide |
| SMILES | N#CCc1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H22ClN3O3S/c22-19-10-7-17(21(26)24-18-8-5-16(6-9-18)11-12-23)15-20(19)29(27,28)25-13-3-1-2-4-14-25/h5-10,15H,1-4,11,13-14H2,(H,24,26) |
| InChIKey | XSGTZNTYOQIMCH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |