C20H23ClN2O3S — CID 2683305
4-chloro-N-(3,5-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 2683305) has the molecular formula C20H23ClN2O3S and a molecular weight of 406.94 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(3,5-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2683305 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-chloro-N-(3,5-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C20H23ClN2O3S/c1-14-10-15(2)12-17(11-14)22-20(24)16-6-7-18(21)19(13-16)27(25,26)23-8-4-3-5-9-23/h6-7,10-13H,3-5,8-9H2,1-2H3,(H,22,24) |
| InChIKey | NKGZFUXJEWXBMZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |