C27H30ClN3O5S2 — CID 4001092
N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]benzamide (PubChem CID 4001092) has the molecular formula C27H30ClN3O5S2 and a molecular weight of 576.14 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4001092 |
| Molecular Formula | C27H30ClN3O5S2 |
| Molecular Weight | 576.14 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2cc(C(=O)Nc3ccc(S(=O)(=O)N4CCCCCC4)cc3)ccc2Cl)c1 |
| InChI | InChI=1S/C27H30ClN3O5S2/c1-19-15-20(2)17-23(16-19)30-37(33,34)26-18-21(7-12-25(26)28)27(32)29-22-8-10-24(11-9-22)38(35,36)31-13-5-3-4-6-14-31/h7-12,15-18,30H,3-6,13-14H2,1-2H3,(H,29,32) |
| InChIKey | AKXNATYALYFMQE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.14 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |