C24H24ClN3O5S2 — CID 43907992
3-chloro-4-[(4-methylphenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 43907992) has the molecular formula C24H24ClN3O5S2 and a molecular weight of 534.06 g/mol. Its IUPAC name is 3-chloro-4-[(4-methylphenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 3-chloro-4-[(4-methylphenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 43907992 |
| Molecular Formula | C24H24ClN3O5S2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 3-chloro-4-[(4-methylphenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(S(=O)(=O)N4CCCC4)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3O5S2/c1-17-4-9-20(10-5-17)34(30,31)27-23-13-6-18(16-22(23)25)24(29)26-19-7-11-21(12-8-19)35(32,33)28-14-2-3-15-28/h4-13,16,27H,2-3,14-15H2,1H3,(H,26,29) |
| InChIKey | BMOZOJFPOUSEDM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |