C24H25N3O5S2 — CID 3291501
4-[(4-methylphenyl)sulfamoyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 3291501) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfamoyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 4-[(4-methylphenyl)sulfamoyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 3291501 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 4-[(4-methylphenyl)sulfamoyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)Nc3cccc(S(=O)(=O)N4CCCC4)c3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O5S2/c1-18-7-11-20(12-8-18)26-33(29,30)22-13-9-19(10-14-22)24(28)25-21-5-4-6-23(17-21)34(31,32)27-15-2-3-16-27/h4-14,17,26H,2-3,15-16H2,1H3,(H,25,28) |
| InChIKey | HUYDKRHTYVGJDW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |