C23H22ClN3O5S2 — CID 5101960
N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 5101960) has the molecular formula C23H22ClN3O5S2 and a molecular weight of 520.03 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 5101960 |
| Molecular Formula | C23H22ClN3O5S2 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ccccc2Cl)c1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H22ClN3O5S2/c24-21-8-1-2-9-22(21)26-33(29,30)20-7-5-6-18(16-20)25-23(28)17-10-12-19(13-11-17)34(31,32)27-14-3-4-15-27/h1-2,5-13,16,26H,3-4,14-15H2,(H,25,28) |
| InChIKey | RNUZAWDNSXEITB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |