C23H20ClN3O4S — CID 4570058
N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 4570058) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 4570058 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ccccc2Cl)c1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C23H20ClN3O4S/c24-20-7-1-2-8-21(20)26-32(30,31)19-6-3-5-17(15-19)25-23(29)16-10-12-18(13-11-16)27-14-4-9-22(27)28/h1-3,5-8,10-13,15,26H,4,9,14H2,(H,25,29) |
| InChIKey | APPAJEXNRODJJO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |