C20H24N2O3S — CID 71904572
4-(azepan-1-ylsulfonyl)-N-(3-methylphenyl)benzamide (PubChem CID 71904572) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(3-methylphenyl)benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 71904572 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-16-7-6-8-18(15-16)21-20(23)17-9-11-19(12-10-17)26(24,25)22-13-4-2-3-5-14-22/h6-12,15H,2-5,13-14H2,1H3,(H,21,23) |
| InChIKey | GGFMJXBOFAKMTK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |