C23H23N3O5S2 — CID 46474292
N-[3-(benzenesulfonamido)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 46474292) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-(benzenesulfonamido)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46474292 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[3-(benzenesulfonamido)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cccc(NS(=O)(=O)c2ccccc2)c1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C23H23N3O5S2/c27-23(18-8-6-13-22(16-18)33(30,31)26-14-4-5-15-26)24-19-9-7-10-20(17-19)25-32(28,29)21-11-2-1-3-12-21/h1-3,6-13,16-17,25H,4-5,14-15H2,(H,24,27) |
| InChIKey | RUDPZCWJGMYFMZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |