C17H17N2O6S2- — CID 8015545
3-[(3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]benzoate (PubChem CID 8015545) has the molecular formula C17H17N2O6S2- and a molecular weight of 409.47 g/mol. Its IUPAC name is 3-[(3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]benzoate.
| Compound Name | 3-[(3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8015545 |
| Molecular Formula | C17H17N2O6S2- |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 3-[(3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]benzoate |
| SMILES | O=C([O-])c1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C17H18N2O6S2/c20-17(21)13-5-3-7-15(11-13)26(22,23)18-14-6-4-8-16(12-14)27(24,25)19-9-1-2-10-19/h3-8,11-12,18H,1-2,9-10H2,(H,20,21)/p-1 |
| InChIKey | DCMIZRRZFBWZJK-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |