C16H14NO4S- — CID 8001167
3-(2,3-dihydro-1H-inden-5-ylsulfamoyl)benzoate (PubChem CID 8001167) has the molecular formula C16H14NO4S- and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfamoyl)benzoate.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8001167 |
| Molecular Formula | C16H14NO4S- |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfamoyl)benzoate |
| SMILES | O=C([O-])c1cccc(S(=O)(=O)Nc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C16H15NO4S/c18-16(19)13-5-2-6-15(10-13)22(20,21)17-14-8-7-11-3-1-4-12(11)9-14/h2,5-10,17H,1,3-4H2,(H,18,19)/p-1 |
| InChIKey | BRNWNNJGARYUNW-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |