C20H15N2O5S- — CID 4100122
3-[[3-(phenylcarbamoyl)phenyl]sulfonylamino]benzoate (PubChem CID 4100122) has the molecular formula C20H15N2O5S- and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-[[3-(phenylcarbamoyl)phenyl]sulfonylamino]benzoate.
| Compound Name | 3-[[3-(phenylcarbamoyl)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4100122 |
| Molecular Formula | C20H15N2O5S- |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 3-[[3-(phenylcarbamoyl)phenyl]sulfonylamino]benzoate |
| SMILES | O=C([O-])c1cccc(NS(=O)(=O)c2cccc(C(=O)Nc3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H16N2O5S/c23-19(21-16-8-2-1-3-9-16)14-6-5-11-18(13-14)28(26,27)22-17-10-4-7-15(12-17)20(24)25/h1-13,22H,(H,21,23)(H,24,25)/p-1 |
| InChIKey | ABZSGEXLJUOXER-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |