C24H20N4O5S2 — CID 92677705
3-(benzenesulfonamido)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 92677705) has the molecular formula C24H20N4O5S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 92677705 |
| Molecular Formula | C24H20N4O5S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H20N4O5S2/c29-24(18-7-6-8-20(17-18)27-34(30,31)21-9-2-1-3-10-21)26-19-12-14-22(15-13-19)35(32,33)28-23-11-4-5-16-25-23/h1-17,27H,(H,25,28)(H,26,29) |
| InChIKey | MQKGBXORLGJAGZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |