C18H15N3O6S2 — CID 4918646
4-[[4-(pyridin-2-ylsulfamoyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 4918646) has the molecular formula C18H15N3O6S2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 4-[[4-(pyridin-2-ylsulfamoyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[4-(pyridin-2-ylsulfamoyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 4918646 |
| Molecular Formula | C18H15N3O6S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 4-[[4-(pyridin-2-ylsulfamoyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C18H15N3O6S2/c22-18(23)13-4-8-15(9-5-13)28(24,25)20-14-6-10-16(11-7-14)29(26,27)21-17-3-1-2-12-19-17/h1-12,20H,(H,19,21)(H,22,23) |
| InChIKey | KBUCSBLPAOYUON-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |