C21H18F3N3O5S — CID 53257044
4-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 53257044) has the molecular formula C21H18F3N3O5S and a molecular weight of 481.45 g/mol. Its IUPAC name is 4-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53257044 |
| Molecular Formula | C21H18F3N3O5S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 4-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H17N3O3S.C2HF3O2/c1-14-5-7-15(8-6-14)19(23)21-16-9-11-17(12-10-16)26(24,25)22-18-4-2-3-13-20-18;3-2(4,5)1(6)7/h2-13H,1H3,(H,20,22)(H,21,23);(H,6,7) |
| InChIKey | ZKXKPMXUQWYIOA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |