C26H23N3O3S2 — CID 28635441
4-[(4-methylphenyl)sulfanylmethyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 28635441) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfanylmethyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-[(4-methylphenyl)sulfanylmethyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28635441 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 4-[(4-methylphenyl)sulfanylmethyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(SCc2ccc(C(=O)Nc3ccc(S(=O)(=O)Nc4ccccn4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O3S2/c1-19-5-13-23(14-6-19)33-18-20-7-9-21(10-8-20)26(30)28-22-11-15-24(16-12-22)34(31,32)29-25-4-2-3-17-27-25/h2-17H,18H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | QTUYJDXQSXHAGM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |