C19H17N3OS — CID 145039707
4-methyl-N-[4-(pyridin-2-ylamino)sulfanylphenyl]benzamide (PubChem CID 145039707) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-methyl-N-[4-(pyridin-2-ylamino)sulfanylphenyl]benzamide.
| Compound Name | 4-methyl-N-[4-(pyridin-2-ylamino)sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 145039707 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-methyl-N-[4-(pyridin-2-ylamino)sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(SNc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C19H17N3OS/c1-14-5-7-15(8-6-14)19(23)21-16-9-11-17(12-10-16)24-22-18-4-2-3-13-20-18/h2-13H,1H3,(H,20,22)(H,21,23) |
| InChIKey | JUTZIPBQWUJMHR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|